PRODUCTS
Founded in 1989, Suzhou Hualun Chemical Co., Ltd. mainly engages in the R&D, production and sales of organic peroxides, flame retardant products.
Benzoyl chloride
| Product name: | Benzoyl chloride |
| Alias: | Benzoyl chloride 99.5+ % for analysis; Benzoil chloride; 4-Chlorocarbonylpolystyrene; alpha-chloro-benzaldehyd; O-Chloroformylbenzene |
| English name: | Benzoyl chloride |
| Alias: | Benzoyl chloride 99.5+ % for analysis; Benzoil chloride; 4-Chlorocarbonylpolystyrene; alpha-chloro-benzaldehyd; O-Chloroformylbenzene |
| CAS RN: | 98-88-4 |
| EINECS No.: | 202-710-8 |
| Molecular formula: | C7H5ClO |
| Molecular weight: | 140.56 |
| InChI: | InChI=1/C7H5ClO/c8-7(9)6-4-2-1-3-5-6/h1-5H |
| Molecular structure: |
 |
| Density: | 1.2188 |
| Melting point: | -1℃ |
| Boiling point: | 198℃ |
| Flash point: | 68℃ |
| Solubility: | reacts |
Copyright(C)2016,Suzhou Hualun Chemical Co., Ltd. All Rights Reserved.
Supported by ChemNet ChinaChemNet Toocle Copyright Notice
Supported by ChemNet ChinaChemNet Toocle Copyright Notice